Ligand name: Bupropion
PDB ligand accession: n/a
DrugBank: DB01156
InChI Key:
SMILES: CC(NC(C)(C)C)C(=O)C1=CC(Cl)=CC=C1

List of proteins that are targets for DB01156

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P46098_DB01156	P46098	5-hydroxytryptamine receptor 3A	negative modulator
2	Q01959_DB01156	Q01959	Sodium-dependent dopamine transporter	inhibitor	Ki(nM) = 173.0 IC50(nM) = 330.0
3	P23975_DB01156	P23975	Sodium-dependent noradrenaline transporter	inhibitor	Ki(nM) = 3642.0 IC50(nM) = 443.0
4	P32297_DB01156	P32297	Neuronal acetylcholine receptor	antagonist	IC50(nM) = 1800.0