Ligand name: Naloxone
PDB ligand accession: n/a
DrugBank: DB01183
InChI Key: UZHSEJADLWPNLE-GRGSLBFTSA-N
SMILES: C=CCN1CCC23c4c5ccc(c4OC2C(=O)CCC3(C1C5)O)O

List of proteins that are targets for DB01183

#	DrugDomain Data	UniProt Accession	Drug Action	Affinity data
1	P35372_DB01183	P35372	antagonist	Ki(nM) = 0.23 IC50(nM) = 2.0
2	P41145_DB01183	P41145	antagonist	Ki(nM) = 0.25 IC50(nM) = 1.5 EC50(nM) = 6.6
3	P41143_DB01183	P41143	antagonist	Ki(nM) = 16.0 IC50(nM) = 4.3
4	P03372_DB01183	P03372	antagonist
5	O00206_DB01183	O00206	inhibitor
6	P23141_DB01183	P23141	binder