Ligand name: Oxymorphone
PDB ligand accession: n/a
DrugBank: DB01192
InChI Key:
SMILES: [H][C@@]12OC3=C(O)C=CC4=C3[C@@]11CCN(C)[C@]([H])(C4)[C@]1(O)CCC2=O

List of proteins that are targets for DB01192

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P35372_DB01192	P35372	Mu-type opioid receptor	agonist	Ki(nM) = 1.8 EC50(nM) = 7.8
2	P41143_DB01192	P41143	Delta-type opioid receptor	antagonist	Ki(nM) = 50.0 IC50(nM) = 45.0