PDB ligand accession: 08Y
DrugBank: DB01200
PubChem:
ChEMBL:
InChI Key: OZVBMTJYIDMWIL-AYFBDAFISA-N
SMILES: CC(C)CC1C(=O)N2CCCC2C3(N1C(=O)C(O3)(C(C)C)NC(=O)C4CN(C5Cc6c7c(cccc7[nH]c6Br)C5=C4)C)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Alkaloids and derivatives
- Class: Ergoline and derivatives
- Subclass: Lysergic acids and derivatives
- Class: Ergoline and derivatives
- Superclass: Alkaloids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P18089_08Y | P18089 | Alpha-2B adrenergic receptor | agonist | Ki(nM) = 34.67 |
2 | P25100_08Y | P25100 | Alpha-1D adrenergic receptor | agonist | Ki(nM) = 1.12 |
3 | P34969_08Y | P34969 | 5-hydroxytryptamine receptor 7 | antagonist | |
4 | P21918_08Y | P21918 | D(1B) dopamine receptor | agonist | Ki(nM) = 454.0 |
5 | P14416_08Y | P14416 | D(2) dopamine receptor | agonist | Ki(nM) = 0.62 |
6 | P21917_08Y | P21917 | D(4) dopamine receptor | antagonist | Ki(nM) = 285.0 |
7 | P35368_08Y | P35368 | Alpha-1B adrenergic receptor | antagonist | Ki(nM) = 1.38 |
8 | P28221_08Y | P28221 | 5-hydroxytryptamine receptor 1D | agonist | Ki(nM) = 10.72 |
9 | P08908_08Y | P08908 | 5-hydroxytryptamine receptor 1A | agonist | Ki(nM) = 12.88 |
10 | P35348_08Y | P35348 | Alpha-1A adrenergic receptor | antagonist | Ki(nM) = 4.17 |
11 | P21728_08Y | P21728 | D(1A) dopamine receptor | agonist | Ki(nM) = 672.0 |
12 | P28222_08Y | P28222 | 5-hydroxytryptamine receptor 1B | agonist | Ki(nM) = 354.81 |
13 | P0ABE7_08Y | P0ABE7 | Soluble cytochrome b562 | n/a | |
14 | P08684_08Y | P08684 | Cytochrome P450 3A4 | n/a | IC50(nM) = 2999.0 |
15 | P08913_08Y | P08913 | Alpha-2A adrenergic receptor | agonist | Ki(nM) = 10.96 |
16 | D9IEF7_08Y | D9IEF7 | Endolysin (EC 3.2.1.17) | n/a | |
17 | P18825_08Y | P18825 | Alpha-2C adrenergic receptor | agonist | Ki(nM) = 28.18 |
18 | P28335_08Y | P28335 | 5-hydroxytryptamine receptor 2C | agonist | Ki(nM) = 741.31 |
19 | P35462_08Y | P35462 | D(3) dopamine receptor | agonist | Ki(nM) = 2.1 |
20 | P28223_08Y | P28223 | 5-hydroxytryptamine receptor 2A | agonist | Ki(nM) = 107.15 |
21 | P41595_08Y | P41595 | 5-hydroxytryptamine receptor 2B | agonist | Ki(nM) = 56.23 |