Ligand name: ethyl 8-fluoro-5-methyl-6-oxo-5,6-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate
PDB ligand accession: FYP
DrugBank: DB01205
PubChem: 3373
ChEMBL: CHEMBL407
InChI Key: OFBIFZUFASYYRE-UHFFFAOYSA-N
SMILES: CCOC(=O)c1c2n(cn1)-c3ccc(cc3C(=O)N(C2)C)F

ClassyFire chemical classification:

List of proteins that are targets for DB01205

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 P31644_FYP P31644 Gamma-aminobutyric acid receptor antagonist Ki(nM) = 0.6
2 P18507_FYP P18507 Gamma-aminobutyric acid receptor antagonist Ki(nM) = 0.19
3 P14867_FYP P14867 Gamma-aminobutyric acid receptor antagonist Ki(nM) = 0.48