PDB ligand accession: 1N1
DrugBank: DB01254
PubChem:
ChEMBL:
InChI Key: ZBNZXTGUTAYRHI-UHFFFAOYSA-N
SMILES: Cc1cccc(c1NC(=O)c2cnc(s2)Nc3cc(nc(n3)C)N4CCN(CC4)CCO)Cl
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Anilides
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P10721_1N1 | P10721 | Mast/stem cell growth | antagonist | Ki(nM) = 620.0 IC50(nM) = 1.0 Kd(nM) = 0.4 |
| 2 | P07947_1N1 | P07947 | Tyrosine-protein kinase Yes | inhibitor | IC50(nM) = 0.5 Kd(nM) = 0.3 |
| 3 | P00519_1N1 | P00519 | Tyrosine-protein kinase ABL1 | inhibitor | IC50(nM) = 0.138 Kd(nM) = 0.016 EC50(nM) = 0.04 |
| 4 | P35991_1N1 | P35991 | Tyrosine-protein kinase BTK | n/a | |
| 5 | Q99640_1N1 | Q99640 | Membrane-associated tyrosine- and | n/a | Ki(nM) = 0.5 IC50(nM) = 6.0 Kd(nM) = 130.0 |
| 6 | Q06187_1N1 | Q06187 | Tyrosine-protein kinase BTK | inhibitor | IC50(nM) = 1.3 Kd(nM) = 1.4 |
| 7 | O94804_1N1 | O94804 | Serine/threonine-protein kinase 10 | n/a | Kd(nM) = 1200.0 |
| 8 | A9UJZ9_1N1 | A9UJZ9 | mitogen-activated protein kinase | n/a | |
| 9 | Q06203_1N1 | Q06203 | Amidophosphoribosyltransferase (ATase) (EC | binder | |
| 10 | P00523_1N1 | P00523 | Proto-oncogene tyrosine-protein kinase | n/a | IC50(nM) = 0.4 Kd(nM) = 0.07 |
| 11 | P02766_1N1 | P02766 | Transthyretin (ATTR) (Prealbumin) | n/a | Kd(nM) = 3100.0 |
| 12 | Q9NYL2_1N1 | Q9NYL2 | Mitogen-activated protein kinase | binder | Kd(nM) = 45.0 |
| 13 | P09769_1N1 | P09769 | Tyrosine-protein kinase Fgr | inhibitor | IC50(nM) = 10.0 Kd(nM) = 0.5 |
| 14 | P51692_1N1 | P51692 | Signal transducer and | inhibitor | |
| 15 | Q13882_1N1 | Q13882 | Protein-tyrosine kinase 6 | n/a | IC50(nM) = 5.3 Kd(nM) = 7.8 |
| 16 | P11142_1N1 | P11142 | Heat shock cognate | binder | |
| 17 | Q16539_1N1 | Q16539 | Mitogen-activated protein kinase | binder | IC50(nM) = 100.0 Kd(nM) = 27.0 EC50(nM) = 470.0 |
| 18 | P09619_1N1 | P09619 | Platelet-derived growth factor | antagonist | IC50(nM) = 28.0 Kd(nM) = 0.63 |
| 19 | P42684_1N1 | P42684 | Tyrosine-protein kinase ABL2 | multitarget | IC50(nM) = 2100.0 Kd(nM) = 0.17 |
| 20 | P42685_1N1 | P42685 | Tyrosine-protein kinase FRK | binder | IC50(nM) = 10.0 Kd(nM) = 0.31 |
| 21 | P29317_1N1 | P29317 | Ephrin type-A receptor | antagonist | IC50(nM) = 0.8 Kd(nM) = 0.85 |
| 22 | Q9Y6E0_1N1 | Q9Y6E0 | Serine/threonine-protein kinase 24 | n/a | Kd(nM) = 10000.0 |
| 23 | P11274_1N1 | P11274 | Breakpoint cluster region | inhibitor | |
| 24 | P54756_1N1 | P54756 | Ephrin type-A receptor | inhibitor | Kd(nM) = 0.24 |
| 25 | Q92570_1N1 | Q92570 | Nuclear receptor subfamily | inhibitor | |
| 26 | P25911_1N1 | P25911 | Tyrosine-protein kinase Lyn | n/a | |
| 27 | Q08345_1N1 | Q08345 | Epithelial discoidin domain-containing | n/a | IC50(nM) = 0.5 Kd(nM) = 0.69 |
| 28 | P06241_1N1 | P06241 | Tyrosine-protein kinase Fyn | inhibitor | IC50(nM) = 0.5 Kd(nM) = 0.79 |
| 29 | P06239_1N1 | P06239 | Tyrosine-protein kinase Lck | inhibitor | IC50(nM) = 0.4 Kd(nM) = 0.2 |
| 30 | P12931_1N1 | P12931 | Proto-oncogene tyrosine-protein kinase | inhibitor | Ki(nM) = 0.016 IC50(nM) = 0.21 Kd(nM) = 0.21 |
| 31 | P51813_1N1 | P51813 | Cytoplasmic tyrosine-protein kinase | n/a | Kd(nM) = 1.4 |
| 32 | Q03137_1N1 | Q03137 | Ephrin type-A receptor | n/a | |
| 33 | F8VQH0_1N1 | F8VQH0 | Tyrosine-protein kinase (EC | n/a | |
| 34 | P41240_1N1 | P41240 | Tyrosine-protein kinase CSK | inhibitor | IC50(nM) = 1.3 Kd(nM) = 1.0 |
| 35 | P07948_1N1 | P07948 | Tyrosine-protein kinase Lyn | inhibitor | IC50(nM) = 1.2 Kd(nM) = 0.57 |
| 36 | P54760_1N1 | P54760 | Ephrin type-B receptor | inhibitor | Kd(nM) = 0.34 |