PDB ligand accession: 017
DrugBank: DB01264
PubChem:
ChEMBL:
InChI Key: CJBJHOAVZSMMDJ-HEXNFIEUSA-N
SMILES: CC(C)CN(CC(C(Cc1ccccc1)NC(=O)OC2COC3C2CCO3)O)S(=O)(=O)c4ccc(cc4)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Benzenesulfonamides
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | Q000H7_017 | Q000H7 | Pol protein | n/a | |
| 2 | P03367_017 | P03367 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | Ki(nM) = 0.014 EC50(nM) = 1.6 |
| 3 | P16088_017 | P16088 | Pol polyprotein [Cleaved | n/a | |
| 4 | P35963_017 | P35963 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
| 5 | P00791_017 | P00791 | Pepsin A (EC | n/a | |
| 6 | Q5RTL1_017 | Q5RTL1 | Protease | n/a | |
| 7 | P04584_017 | P04584 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
| 8 | Q673V0_017 | Q673V0 | Pol protein | n/a | |
| 9 | Q8ULI3_017 | Q8ULI3 | Protease | n/a | |
| 10 | Q9WFL7_017 | Q9WFL7 | Pol polyprotein | n/a | |
| 11 | Q9QB59_017 | Q9QB59 | HIV-1 protease | n/a | |
| 12 | Q6B6C5_017 | Q6B6C5 | Protease | n/a | |
| 13 | Q7SSI0_017 | Q7SSI0 | Protease | n/a | |
| 14 | C8BD48_017 | C8BD48 | Protease | n/a | |
| 15 | Q8ULI9_017 | Q8ULI9 | Protease | n/a | |
| 16 | Q7ZCR0_017 | Q7ZCR0 | Protease | n/a | |
| 17 | V5YAB1_017 | V5YAB1 | Pol protein | n/a | |
| 18 | Q7SRW9_017 | Q7SRW9 | Protease | n/a | |
| 19 | P03369_017 | P03369 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
| 20 | P03368_017 | P03368 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
| 21 | Q3HWC9_017 | Q3HWC9 | Pol protein | n/a | |
| 22 | P04587_017 | P04587 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
| 23 | P12499_017 | P12499 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
| 24 | Q993Q5_017 | Q993Q5 | Pol polyprotein | n/a | |
| 25 | Q9J006_017 | Q9J006 | Protease | n/a | |
| 26 | V5Y949_017 | V5Y949 | Pol protein | n/a | |
| 27 | O38896_017 | O38896 | Protease | n/a | |
| 28 | A0A1Y1C9N2_017 | A0A1Y1C9N2 | Pro protein | n/a | |
| 29 | Q7ZCI0_017 | Q7ZCI0 | Protease | n/a | |
| 30 | I7BFC3_017 | I7BFC3 | Protease | n/a | |
| 31 | Q7ZCL2_017 | Q7ZCL2 | Protease | n/a |