Ligand name: Yohimbine
PDB ligand accession: n/a
DrugBank: DB01392
InChI Key:
SMILES: [H][C@@]12CC[C@H](O)[C@H](C(=O)OC)[C@@]1([H])C[C@]1([H])N(CCC3=C1NC1=CC=CC=C31)C2

List of proteins that are targets for DB01392

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P14416_DB01392	P14416	D(2) dopamine receptor	antagonist	Ki(nM) = 280.0
2	P41595_DB01392	P41595	5-hydroxytryptamine receptor 2B	antagonist	Ki(nM) = 4.12
3	P18825_DB01392	P18825	Alpha-2C adrenergic receptor	antagonist	Ki(nM) = 0.13 IC50(nM) = 27.1
4	P28335_DB01392	P28335	5-hydroxytryptamine receptor 2C	antagonist	Ki(nM) = 645.65
5	P28223_DB01392	P28223	5-hydroxytryptamine receptor 2A	antagonist	Ki(nM) = 252.0
6	P28221_DB01392	P28221	5-hydroxytryptamine receptor 1D	partial agonist	Ki(nM) = 15.84
7	P18089_DB01392	P18089	Alpha-2B adrenergic receptor	antagonist	Ki(nM) = 0.32
8	P28222_DB01392	P28222	5-hydroxytryptamine receptor 1B	partial agonist	Ki(nM) = 5.0
9	P35462_DB01392	P35462	D(3) dopamine receptor	antagonist	Ki(nM) = 2489.0
10	P08908_DB01392	P08908	5-hydroxytryptamine receptor 1A	partial agonist	Ki(nM) = 50.11
11	P08913_DB01392	P08913	Alpha-2A adrenergic receptor	antagonist	Ki(nM) = 0.32 IC50(nM) = 3.67 Kd(nM) = 2300.0 EC50(nM) = 8.5