Ligand name: Midomafetamine
PDB ligand accession: n/a
DrugBank: DB01454
InChI Key:
SMILES: CNC(C)CC1=CC2=C(OCO2)C=C1

List of proteins that are targets for DB01454

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P28335_DB01454	P28335	5-hydroxytryptamine receptor 2C	agonist
2	Q01959_DB01454	Q01959	Sodium-dependent dopamine transporter	negative modulator	Ki(nM) = 10000.0 IC50(nM) = 1442.0 EC50(nM) = 1000.0
3	P23975_DB01454	P23975	Sodium-dependent noradrenaline transporter	negative modulator	Ki(nM) = 10000.0 IC50(nM) = 405.0 EC50(nM) = 1000.0
4	P41595_DB01454	P41595	5-hydroxytryptamine receptor 2B	agonist	Ki(nM) = 500.0
5	P31645_DB01454	P31645	Sodium-dependent serotonin transporter	negative modulator	Ki(nM) = 0.73 IC50(nM) = 384.0 EC50(nM) = 1000.0
6	P28223_DB01454	P28223	5-hydroxytryptamine receptor 2A	agonist