PDB ligand accession: AB1
DrugBank: DB01601
PubChem:
ChEMBL:
InChI Key: KJHKTHWMRKYKJE-SUGCFTRWSA-N
SMILES: Cc1cccc(c1OCC(=O)NC(Cc2ccccc2)C(CC(Cc3ccccc3)NC(=O)C(C(C)C)N4CCCNC4=O)O)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q8I6V3_AB1 | Q8I6V3 | Plasmepsin II (EC | n/a | |
2 | P04587_AB1 | P04587 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
3 | Q903J0_AB1 | Q903J0 | Protease | n/a | |
4 | Q8ULI9_AB1 | Q8ULI9 | Protease | n/a | |
5 | P16088_AB1 | P16088 | Pol polyprotein [Cleaved | n/a | |
6 | Q000H7_AB1 | Q000H7 | Pol protein | n/a | |
7 | P03367_AB1 | P03367 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
8 | O38732_AB1 | O38732 | Protease | n/a | |
9 | Q5RZ08_AB1 | Q5RZ08 | Protease | n/a | |
10 | Q9QM22_AB1 | Q9QM22 | Protease | n/a | |
11 | A0F7J4_AB1 | A0F7J4 | Pol protein | n/a |