PDB ligand accession: PRT
DrugBank: DB01661
PubChem: n/a
ChEMBL: n/a
InChI Key: RKNHJBVBFHDXGR-DNVSJNHSSA-N
SMILES: c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=CN(C2=N)C4C(C(C(O4)COP(=O)(O)O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Nucleosides, nucleotides, and analogues
- Class: Purine nucleotides
- Subclass: Purine ribonucleotides
- Class: Purine nucleotides
- Superclass: Nucleosides, nucleotides, and analogues
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P60757_PRT | P60757 | ATP phosphoribosyltransferase (ATP-PRT) | n/a | |
| 2 | Q5HSJ4_PRT | Q5HSJ4 | ATP phosphoribosyltransferase (ATP-PRT) | n/a | |
| 3 | Q4FQF7_PRT | Q4FQF7 | ATP phosphoribosyltransferase (ATP-PRT) | n/a |