PDB ligand accession: PTT
DrugBank: DB01794
PubChem: n/a
ChEMBL: n/a
InChI Key: OMJGSXGVFAOTGU-BYZPVVMBSA-G
SMILES: COc1c2c(nc(n1)N)NC3C(N2)C4=C5C(O3)COP(=O)(O[Mg]OP(=O)(OCC6C7=C(C8C(O6)NC9=C(N8)C(=O)NC(=N9)N)S[W](S5)(S7)(S4)O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pteridines and derivatives
- Subclass: Pterins and derivatives
- Class: Pteridines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | O93738_PTT | O93738 | Formaldehyde ferredoxin oxidoreductase | n/a | |
2 | Q8U1K3_PTT | Q8U1K3 | Formaldehyde:ferredoxin oxidoreductase | n/a |