PDB ligand accession: A3P
DrugBank: DB01812
PubChem:
ChEMBL:
InChI Key: WHTCPDAXWFLDIH-KQYNXXCUSA-N
SMILES: c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)O)OP(=O)(O)O)O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Nucleosides, nucleotides, and analogues
- Class: Purine nucleotides
- Subclass: Purine ribonucleotides
- Class: Purine nucleotides
- Superclass: Nucleosides, nucleotides, and analogues
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q9Y663_A3P | Q9Y663 | Heparan sulfate glucosamine | n/a | |
2 | O00338_A3P | O00338 | Sulfotransferase 1C2 (ST1C2) | n/a | |
3 | P50225_A3P | P50225 | Sulfotransferase 1A1 (ST1A1) | n/a | |
4 | Q7RB63_A3P | Q7RB63 | 4'-phosphopantetheinyl transferase domain-containing | n/a | |
5 | P50224_A3P | P50224 | Sulfotransferase 1A3 (ST1A3) | n/a | |
6 | O60704_A3P | O60704 | Protein-tyrosine sulfotransferase 2 | n/a | |
7 | P49888_A3P | P49888 | Sulfotransferase 1E1 (ST1E1) | n/a | |
8 | O00204_A3P | O00204 | Sulfotransferase 2B1 (EC | n/a | |
9 | P0AA25_A3P | P0AA25 | Thioredoxin 1 (Trx-1) | n/a | |
10 | X5MEI1_A3P | X5MEI1 | 3'-5' exonuclease | n/a | |
11 | B7ZWN4_A3P | B7ZWN4 | Sulfotransferase (EC 2.8.2.-) | n/a | |
12 | Q9R2C2_A3P | Q9R2C2 | Sulfotransferase 1 family | n/a | |
13 | P0A2W6_A3P | P0A2W6 | Holo-[acyl-carrier-protein] synthase (Holo-ACP | n/a | |
14 | P0AEY0_A3P | P0AEY0 | Maltose/maltodextrin-binding periplasmic protein | n/a | |
15 | F4Y423_A3P | F4Y423 | CurM (Polyketide synthase | n/a | |
16 | P9WKJ0_A3P | P9WKJ0 | 3'-phosphoadenosine 5'-phosphate phosphatase | n/a | |
17 | P10153_A3P | P10153 | Non-secretory ribonuclease (EC | n/a | |
18 | P49891_A3P | P49891 | Sulfotransferase 1E1 (ST1E1) | n/a | |
19 | A0A094ZWQ2_A3P | A0A094ZWQ2 | Nad dependent epimerase/dehydratase | n/a | |
20 | Q8KLM3_A3P | Q8KLM3 | Desulfo-A47934 sulfotransferase (EC | n/a | |
21 | Q9C9C9_A3P | Q9C9C9 | Cytosolic sulfotransferase 18 | n/a | |
22 | P52848_A3P | P52848 | Bifunctional heparan sulfate | n/a | |
23 | O14792_A3P | O14792 | Heparan sulfate glucosamine | n/a | |
24 | O35310_A3P | O35310 | Heparan sulfate glucosamine | n/a | |
25 | O34600_A3P | O34600 | Bifunctional oligoribonuclease and | n/a | |
26 | A0AAI9EXQ5_A3P | A0AAI9EXQ5 | deleted | n/a | |
27 | Q8BGL3_A3P | Q8BGL3 | Sulfotransferase 2A8 (SULT2A8) | n/a | |
28 | B1XKC6_A3P | B1XKC6 | Polyketide synthase | n/a | |
29 | Q9C9D0_A3P | Q9C9D0 | Cytosolic sulfotransferase 16 | n/a | |
30 | G4VLE5_A3P | G4VLE5 | Sulfotransferase oxamniquine resistance | n/a | |
31 | P50226_A3P | P50226 | Sulfotransferase 1A2 (ST1A2) | n/a | |
32 | P06612_A3P | P06612 | DNA topoisomerase 1 | n/a | |
33 | P07998_A3P | P07998 | Ribonuclease pancreatic (EC | n/a | |
34 | O60507_A3P | O60507 | Protein-tyrosine sulfotransferase 1 | n/a | |
35 | Q81JG3_A3P | Q81JG3 | Holo-[acyl-carrier-protein] synthase (Holo-ACP | n/a | |
36 | O35403_A3P | O35403 | Amine sulfotransferase (EC | n/a | |
37 | Q9Y662_A3P | Q9Y662 | Heparan sulfate glucosamine | n/a | |
38 | Q8IZT8_A3P | Q8IZT8 | Heparan sulfate glucosamine | n/a | |
39 | Q26490_A3P | Q26490 | Retinol dehydratase | n/a | |
40 | C1LER5_A3P | C1LER5 | Cell wall integrity | n/a | |
41 | Q6IMI6_A3P | Q6IMI6 | Sulfotransferase 1C3 (ST1C3) | n/a | |
42 | Q7PXJ0_A3P | Q7PXJ0 | AGAP001425-PA | n/a | |
43 | P18408_A3P | P18408 | Phosphoadenosine phosphosulfate reductase | n/a | |
44 | P0AEX9_A3P | P0AEX9 | Maltose/maltodextrin-binding periplasmic protein | n/a | |
45 | Q9X024_A3P | Q9X024 | Bifunctional NAD(P)H-hydrate repair | n/a | |
46 | Q06520_A3P | Q06520 | Sulfotransferase 2A1 (ST2A1) | n/a | |
47 | P32179_A3P | P32179 | 3'(2'),5'-bisphosphate nucleotidase (EC | n/a | |
48 | O75897_A3P | O75897 | Sulfotransferase 1C4 (ST1C4) | n/a | |
49 | O70348_A3P | O70348 | Decapping and exoribonuclease | n/a | |
50 | P61823_A3P | P61823 | Ribonuclease pancreatic (EC | n/a | |
51 | Q9M6U3_A3P | Q9M6U3 | Hydroxymethylglutaryl-CoA synthase (HMG-CoA | n/a | |
52 | Q9KPB6_A3P | Q9KPB6 | Holo-[acyl-carrier-protein] synthase (Holo-ACP | n/a | |
53 | J7QFC0_A3P | J7QFC0 | Putative mRNA interferase | n/a | |
54 | O43704_A3P | O43704 | Sulfotransferase 1B1 (ST1B1) | n/a |