PDB ligand accession: TYM
DrugBank: DB01831
PubChem: 446202;134820106;
ChEMBL: n/a
InChI Key: IFQVDHDRFCKAAW-SQIXAUHQSA-N
SMILES: c1ccc2c(c1)c(c[nH]2)CC(C(=O)OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Nucleosides, nucleotides, and analogues
- Class: Purine nucleotides
- Subclass: Purine ribonucleotides
- Class: Purine nucleotides
- Superclass: Nucleosides, nucleotides, and analogues
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q8IDW3_TYM | Q8IDW3 | tryptophan--tRNA ligase (EC | n/a | |
2 | O59584_TYM | O59584 | Tryptophan--tRNA ligase (EC | n/a | |
3 | P00953_TYM | P00953 | Tryptophan--tRNA ligase (EC | n/a | |
4 | P23381_TYM | P23381 | Tryptophan--tRNA ligase, cytoplasmic | n/a | |
5 | P00954_TYM | P00954 | Tryptophan--tRNA ligase (EC | n/a | |
6 | Q12109_TYM | Q12109 | Tryptophan--tRNA ligase, cytoplasmic | n/a | |
7 | A0A045IZS3_TYM | A0A045IZS3 | Tryptophan--tRNA ligase (EC | n/a |