PDB ligand accession: UCN
DrugBank: DB01933
PubChem:
ChEMBL:
InChI Key: PBCZSGKMGDDXIJ-HQCWYSJUSA-N
SMILES: CC12C(C(CC(O1)n3c4ccccc4c5c3c6n2c7ccccc7c6c8c5C(=O)NC8O)NC)OC
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Indoles and derivatives
- Subclass: Carbazoles
- Class: Indoles and derivatives
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | O14757_UCN | O14757 | Serine/threonine-protein kinase Chk1 | inhibitor | |
| 2 | O15530_UCN | O15530 | 3-phosphoinositide-dependent protein kinase | n/a | |
| 3 | P24941_UCN | P24941 | Cyclin-dependent kinase 2 | n/a | |
| 4 | P19652_UCN | P19652 | Alpha-1-acid glycoprotein 2 | n/a |