Ligand name: 5-(AMINOMETHYL)-6-(2,4-DICHLOROPHENYL)-2-(3,5-DIMETHOXYPHENYL)PYRIMIDIN-4-AMINE
PDB ligand accession: 5AP
DrugBank: DB02004
PubChem: 448436
ChEMBL: CHEMBL34062
InChI Key: RCJFINNFYUNFGH-UHFFFAOYSA-N
SMILES: COc1cc(cc(c1)OC)c2nc(c(c(n2)N)CN)c3ccc(cc3Cl)Cl

ClassyFire chemical classification:

List of proteins that are targets for DB02004

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 P27487_5AP P27487 Dipeptidyl peptidase 4 n/a IC50(nM) = 0.1