PDB ligand accession: THG
DrugBank: DB02031
PubChem: 5289465;5460413;135398650;
ChEMBL: n/a
InChI Key: MSTNYGQPCMXVAQ-RYUDHWBXSA-N
SMILES: c1cc(ccc1C(=O)NC(CCC(=O)O)C(=O)O)NCC2CNC3=C(N2)C(=O)NC(=N3)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pteridines and derivatives
- Subclass: Pterins and derivatives
- Class: Pteridines and derivatives
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | Q3ACR9_THG | Q3ACR9 | 5-methyltetrahydrofolate corrinoid/iron sulfur | n/a | |
| 2 | P0A884_THG | P0A884 | Thymidylate synthase (TS) | n/a | |
| 3 | Q4FP21_THG | Q4FP21 | Dimethylsulfoniopropionate demethylase DmdA | n/a | |
| 4 | B8FW00_THG | B8FW00 | Dihydropteroate synthase DHPS | n/a | |
| 5 | Q5SID2_THG | Q5SID2 | Methylenetetrahydrofolate--tRNA-(uracil-5-)-methyltransferase TrmFO (EC | n/a | |
| 6 | P08773_THG | P08773 | Deoxycytidylate 5-hydroxymethyltransferase (Deoxycytidylate | n/a | |
| 7 | O34453_THG | O34453 | Nitric oxide synthase | n/a | |
| 8 | O50008_THG | O50008 | 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 | n/a | |
| 9 | Q99707_THG | Q99707 | Methionine synthase (MS) | n/a | |
| 10 | E3NZ06_THG | E3NZ06 | 10-formyltetrahydrofolate dehydrogenase (EC | n/a | |
| 11 | Q9WY54_THG | Q9WY54 | Aminomethyltransferase (EC 2.1.2.10) | n/a | |
| 12 | P0ABQ5_THG | P0ABQ5 | Dihydrofolate reductase (EC | n/a | |
| 13 | G2IQS7_THG | G2IQS7 | Vanillate/3-O-methylgallate O-demethylase (Vanillate/3MGA | n/a | |
| 14 | Q49135_THG | Q49135 | Methenyltetrahydrofolate cyclohydrolase (EC | n/a | |
| 15 | P0ABQ4_THG | P0ABQ4 | Dihydrofolate reductase (EC | n/a | |
| 16 | Q5RKL4_THG | Q5RKL4 | Dimethylglycine dehydrogenase | n/a | |
| 17 | O67224_THG | O67224 | Hydrogenase regulation HoxX | n/a | |
| 18 | Q9AGP8_THG | Q9AGP8 | Dimethylglycine oxidase (DMGO) | n/a | |
| 19 | Q4DLS1_THG | Q4DLS1 | Bifunctional dihydrofolate reductase-thymidylate | n/a | |
| 20 | O60341_THG | O60341 | Lysine-specific histone demethylase | n/a |