PDB ligand accession: IXM
DrugBank: DB02052
PubChem: n/a
ChEMBL:
InChI Key: HBDSHCUSXQATPO-BGBJRWHRSA-N
SMILES: c1ccc2c(c1)C(=C3C(=NO)c4ccccc4N3)C(=O)N2
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Indoles and derivatives
- Subclass: Indolines
- Class: Indoles and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P06493_IXM | P06493 | Cyclin-dependent kinase 1 | binder | |
2 | P35869_IXM | P35869 | Aryl hydrocarbon receptor | agonist | |
3 | Q5CRJ8_IXM | Q5CRJ8 | Cyclin-dependent kinase 2 | n/a | |
4 | Q00535_IXM | Q00535 | Cyclin-dependent kinase 5 | inhibitor | |
5 | P24941_IXM | P24941 | Cyclin-dependent kinase 2 | inhibitor | IC50(nM) = 440.0 |
6 | P49841_IXM | P49841 | Glycogen synthase kinase-3 | n/a | IC50(nM) = 22.0 |