PDB ligand accession: DDS
DrugBank: DB02189
PubChem: 65304;152743111;
ChEMBL:
InChI Key: OAKPWEUQDVLTCN-NKWVEPMBSA-N
SMILES: c1nc(c2c(n1)n(cn2)C3CCC(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Nucleosides, nucleotides, and analogues
- Class: Purine nucleotides
- Subclass: Purine deoxyribonucleotides
- Class: Purine nucleotides
- Superclass: Nucleosides, nucleotides, and analogues
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | C9RTX7_DDS | C9RTX7 | deleted | n/a | |
| 2 | A0A4W6BKE5_DDS | A0A4W6BKE5 | DNA-directed DNA polymerase | n/a | |
| 3 | P0DSP4_DDS | P0DSP4 | Cyclic AMP-AMP-GMP synthase | n/a | |
| 4 | P03366_DDS | P03366 | Gag-Pol polyprotein (Pr160Gag-Pol) | inhibitor | |
| 5 | P19821_DDS | P19821 | DNA polymerase I, | n/a | |
| 6 | O75417_DDS | O75417 | DNA polymerase theta | n/a | |
| 7 | P04053_DDS | P04053 | DNA nucleotidylexotransferase (EC | n/a | |
| 8 | Q97W02_DDS | Q97W02 | DNA polymerase IV | n/a |