PDB ligand accession: PXP
DrugBank: DB02209
PubChem:
ChEMBL: n/a
InChI Key: WHOMFKWHIQZTHY-UHFFFAOYSA-N
SMILES: Cc1c(c(c(cn1)COP(=O)(O)O)CO)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pyridines and derivatives
- Subclass: Pyridoxines
- Class: Pyridines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P07805_PXP | P07805 | Ornithine decarboxylase (ODC) | n/a | |
2 | Q8ZCP4_PXP | Q8ZCP4 | Pyridoxine 5'-phosphate synthase | n/a | |
3 | P11926_PXP | P11926 | Ornithine decarboxylase (ODC) | inhibitor | |
4 | Q9PN59_PXP | Q9PN59 | Pyridoxine 5'-phosphate synthase | n/a | |
5 | P0A794_PXP | P0A794 | Pyridoxine 5'-phosphate synthase | n/a | |
6 | C3SV52_PXP | C3SV52 | Pyridoxal phosphate homeostasis | n/a |