Ligand name: 2-[[3-(TRIFLUOROMETHYL)PHENYL]AMINO] BENZOIC ACID
PDB ligand accession: FLF
DrugBank: DB02266
PubChem: 3371
ChEMBL: CHEMBL23588
InChI Key: LPEPZBJOKDYZAD-UHFFFAOYSA-N
SMILES: c1ccc(c(c1)C(=O)O)Nc2cccc(c2)C(F)(F)F

ClassyFire chemical classification:

List of proteins that are targets for DB02266

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 P10275_FLF P10275 Androgen receptor (Dihydrotestosterone inhibitor IC50(nM) = 50000.0
EC50(nM) = 67000.0
2 P37231_FLF P37231 Peroxisome proliferator-activated receptor agonist
3 P02766_FLF P02766 Transthyretin (ATTR) (Prealbumin) n/a IC50(nM) = 2900.0
Kd(nM) = 30.0
4 O60218_FLF O60218 Aldo-keto reductase family n/a IC50(nM) = 760.0
5 P23219_FLF P23219 Prostaglandin G/H synthase inhibitor IC50(nM) = 2230.0
6 Q15562_FLF Q15562 Transcriptional enhancer factor n/a
7 P35354_FLF P35354 Prostaglandin G/H synthase inhibitor IC50(nM) = 16.0
8 Q07869_FLF Q07869 Peroxisome proliferator-activated receptor activator
9 P42330_FLF P42330 Aldo-keto reductase family inhibitor Ki(nM) = 140.0
IC50(nM) = 50.0