PDB ligand accession: FLF
DrugBank: DB02266
PubChem:
ChEMBL:
InChI Key: LPEPZBJOKDYZAD-UHFFFAOYSA-N
SMILES: c1ccc(c(c1)C(=O)O)Nc2cccc(c2)C(F)(F)F
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Benzoic acids and derivatives
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Drug Action | Affinity data |
---|---|---|---|---|
1 | P10275_FLF | P10275 | inhibitor | IC50(nM) = 50000.0 EC50(nM) = 67000.0 |
2 | P37231_FLF | P37231 | agonist | |
3 | P02766_FLF | P02766 | n/a | IC50(nM) = 2900.0 Kd(nM) = 30.0 |
4 | O60218_FLF | O60218 | n/a | IC50(nM) = 760.0 |
5 | P23219_FLF | P23219 | inhibitor | IC50(nM) = 2230.0 |
6 | Q15562_FLF | Q15562 | n/a | |
7 | P35354_FLF | P35354 | inhibitor | IC50(nM) = 16.0 |
8 | Q07869_FLF | Q07869 | activator | |
9 | P42330_FLF | P42330 | inhibitor | Ki(nM) = 140.0 IC50(nM) = 50.0 |