PDB ligand accession: DST
DrugBank: DB02270
PubChem:
ChEMBL: n/a
InChI Key: ZWFWSISPSBLNGO-UHFFFAOYSA-N
SMILES: CC(=CCSP(=O)(O)OP(=O)(O)O)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Organic phosphoric acids and derivatives
- Subclass: None
- Class: Organic phosphoric acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q4G2I1_DST | Q4G2I1 | Tryprostatin B synthase | n/a | |
2 | Q50EL0_DST | Q50EL0 | Tryptophan dimethylallyltransferase (EC | n/a | |
3 | Q9AR86_DST | Q9AR86 | Isoprene synthase, chloroplastic | n/a | |
4 | P16384_DST | P16384 | tRNA dimethylallyltransferase (EC | n/a | |
5 | P58758_DST | P58758 | Adenylate dimethylallyltransferase (EC | n/a | |
6 | A0A182DWE5_DST | A0A182DWE5 | Prenyltransferase (PriB) | n/a | |
7 | S0EH60_DST | S0EH60 | Dimethylallyltryptophan synthase 1 | n/a | |
8 | A0A1B0UHJ4_DST | A0A1B0UHJ4 | Aromatic prenyltransferase | n/a | |
9 | B8XA40_DST | B8XA40 | (2Z,6Z)-farnesyl diphosphate synthase, | n/a | |
10 | P07884_DST | P07884 | tRNA dimethylallyltransferase (DMATase) | n/a | |
11 | P22939_DST | P22939 | Farnesyl diphosphate synthase | n/a | |
12 | X5IYJ5_DST | X5IYJ5 | Cyclolavandulyl diphosphate synthase | n/a | |
13 | A0A140UHQ1_DST | A0A140UHQ1 | Alkyl transferase (EC | n/a | |
14 | E0Y3X1_DST | E0Y3X1 | Deoxybrevianamide E synthase | n/a | |
15 | F5B6Z0_DST | F5B6Z0 | Putative prenyl transferase | n/a | |
16 | V5TDY7_DST | V5TDY7 | Hapalindole dimethylallyltransferase (EC | n/a | |
17 | A8M6W6_DST | A8M6W6 | Aromatic prenyltransferase, DMATS | n/a | |
18 | D6RT90_DST | D6RT90 | 6-dimethylallyltryptophan synthase (Tryptophan | n/a | |
19 | Q9SBR3_DST | Q9SBR3 | Geranyl diphosphate synthase | n/a | |
20 | I7EIW6_DST | I7EIW6 | Aromatic prenyltransferase | n/a | |
21 | A0A077K887_DST | A0A077K887 | Tryptophan dimethylallyltransferase | n/a |