PDB ligand accession: SHH
DrugBank: DB02546
PubChem:
ChEMBL:
InChI Key: WAEXFXRVDQXREF-UHFFFAOYSA-N
SMILES: c1ccc(cc1)NC(=O)CCCCCCC(=O)NO
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: None
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data | |
---|---|---|---|---|---|---|
1 | A5H660_SHH | A5H660 | histone deacetylase (EC | n/a | ||
2 | Q70I53_SHH | Q70I53 | Histone deacetylase-like amidohydrolase | n/a | Ki(nM) = 1000.0 IC50(nM) = 1000.0 Kd(nM) = 300.0 | |
3 | F1QCV2_SHH | F1QCV2 | Polyamine deacetylase HDAC10 | n/a | ||
4 | O15379_SHH | O15379 | Histone deacetylase 3 | inhibitor | Ki(nM) = 1.7 IC50(nM) = 1.4 | |
5 | Q8WUI4_SHH | Q8WUI4 | Histone deacetylase 7 | inhibitor | Ki(nM) = 129.0 IC50(nM) = 1.0 Kd(nM) = 36000.0 | |
6 | Q13547_SHH | Q13547 | Histone deacetylase 1 | inhibitor | Ki(nM) = 1.9 IC50(nM) = 0.23 Kd(nM) = 40.0 EC50(nM) = 180.0 | |
7 | P09960_SHH | P09960 | Leukotriene A-4 hydrolase | n/a | IC50(nM) = 1670.0 | |
8 | Q9BY41_SHH | Q9BY41 | Histone deacetylase 8 | n/a | inhibitor | Ki(nM) = 173.0 IC50(nM) = 1.0 Kd(nM) = 580.0 |
9 | Q92769_SHH | Q92769 | Histone deacetylase 2 | inhibitor | Ki(nM) = 7.0 IC50(nM) = 1.7 Kd(nM) = 163.0 | |
10 | O67135_SHH | O67135 | Acetoin utilization protein | n/a | ||
11 | A7YT55_SHH | A7YT55 | Hdac6 protein | n/a | ||
12 | Q9UBN7_SHH | Q9UBN7 | Protein deacetylase HDAC6 | inhibitor | Ki(nM) = 1.0 IC50(nM) = 1.4 Kd(nM) = 300.0 EC50(nM) = 22.0 |