PDB ligand accession: IOP
DrugBank: DB02758
PubChem:
ChEMBL:
InChI Key: GOLXRNDWAUTYKT-UHFFFAOYSA-N
SMILES: c1ccc2c(c1)c(c[nH]2)CCC(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Indoles and derivatives
- Subclass: Indolyl carboxylic acids and derivatives
- Class: Indoles and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P59071_IOP | P59071 | Basic phospholipase A2 | n/a | |
2 | Q9NZK7_IOP | Q9NZK7 | Group IIE secretory | n/a | |
3 | P95468_IOP | P95468 | Aromatic-amino-acid aminotransferase (ARAT) | n/a | |
4 | P12499_IOP | P12499 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
5 | P9WPA5_IOP | P9WPA5 | Phosphopantetheine adenylyltransferase (EC | n/a | |
6 | C5CSP2_IOP | C5CSP2 | Transcriptional regulator, MarR | n/a | |
7 | B1MDL6_IOP | B1MDL6 | Phosphopantetheine adenylyltransferase (EC | n/a | |
8 | P0A881_IOP | P0A881 | Trp operon repressor | n/a | |
9 | P00509_IOP | P00509 | Aspartate aminotransferase (AspAT) | n/a |