PDB ligand accession: PLG
DrugBank: DB02824
PubChem:
ChEMBL: n/a
InChI Key: FEVQWBMNLWUBTF-UHFFFAOYSA-N
SMILES: Cc1c(c(c(cn1)COP(=O)(O)O)CNCC(=O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pyridines and derivatives
- Subclass: Pyridoxamines
- Class: Pyridines and derivatives
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P18079_PLG | P18079 | 5-aminolevulinate synthase (EC | n/a | |
| 2 | Q9KM65_PLG | Q9KM65 | CAI-1 autoinducer synthase | n/a | |
| 3 | Q0K313_PLG | Q0K313 | 2-amino-3-ketobutyrate coenzyme A | n/a | |
| 4 | P11926_PLG | P11926 | Ornithine decarboxylase (ODC) | inhibitor | |
| 5 | Q5M0B4_PLG | Q5M0B4 | Serine hydroxymethyltransferase (SHMT) | n/a | |
| 6 | Q84AR1_PLG | Q84AR1 | L-methionine gamma-lyase (EC | n/a | |
| 7 | P34897_PLG | P34897 | Serine hydroxymethyltransferase, mitochondrial | n/a | |
| 8 | P23378_PLG | P23378 | Glycine dehydrogenase (decarboxylating), | n/a | |
| 9 | P50431_PLG | P50431 | Serine hydroxymethyltransferase, cytosolic | n/a | |
| 10 | E7U392_PLG | E7U392 | deleted | n/a | |
| 11 | A0A133CK16_PLG | A0A133CK16 | Serine hydroxymethyltransferase (SHMT) | n/a | |
| 12 | A0A1G4H5I1_PLG | A0A1G4H5I1 | glycine hydroxymethyltransferase (EC | n/a | |
| 13 | O07051_PLG | O07051 | L-allo-threonine aldolase (L-allo-TA) | n/a | |
| 14 | P34896_PLG | P34896 | Serine hydroxymethyltransferase, cytosolic | n/a | |
| 15 | G7ILW0_PLG | G7ILW0 | Serine hydroxymethyltransferase (EC | n/a | |
| 16 | K4FW35_PLG | K4FW35 | Serine hydroxymethyltransferase (EC | n/a | |
| 17 | A0A0R0IK90_PLG | A0A0R0IK90 | Serine hydroxymethyltransferase (EC | n/a | |
| 18 | P75823_PLG | P75823 | Low specificity L-threonine | n/a | |
| 19 | P0A825_PLG | P0A825 | Serine hydroxymethyltransferase (SHMT) | n/a | |
| 20 | A0A4Q8MG35_PLG | A0A4Q8MG35 | deleted | n/a | |
| 21 | Q9X266_PLG | Q9X266 | L-allo-threonine aldolase | n/a | |
| 22 | A5K8L9_PLG | A5K8L9 | glycine hydroxymethyltransferase (EC | n/a | |
| 23 | P07511_PLG | P07511 | Serine hydroxymethyltransferase, cytosolic | n/a | |
| 24 | A7BFV6_PLG | A7BFV6 | Serine palmitoyltransferase (SPT) | n/a | |
| 25 | P07805_PLG | P07805 | Ornithine decarboxylase (ODC) | n/a | |
| 26 | C8W9P2_PLG | C8W9P2 | Cysteine desulfurase (EC | n/a | |
| 27 | K4FZF8_PLG | K4FZF8 | Serine hydroxymethyltransferase (EC | n/a |