PDB ligand accession: ESI
DrugBank: DB03136
PubChem:
ChEMBL: n/a
InChI Key: YERQOXAYAFWFEJ-UHFFFAOYSA-O
SMILES: c1cc2c(cc(s2)C(=[NH2+])N)c(c1)I
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Benzothiophenes
- Subclass: 1-benzothiophenes
- Class: Benzothiophenes
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P00749_ESI | P00749 | Urokinase-type plasminogen activator | inhibitor | Ki(nM) = 210.0 |
| 2 | P00760_ESI | P00760 | Serine protease 1 | n/a | Ki(nM) = 440.0 |
| 3 | P07477_ESI | P07477 | Serine protease 1 | n/a | |
| 4 | P00734_ESI | P00734 | Prothrombin (EC 3.4.21.5) | inhibitor | Ki(nM) = 20000.0 |