PDB ligand accession: DTR
DrugBank: DB03225
PubChem: 9060;6923517;
ChEMBL:
InChI Key: QIVBCDIJIAJPQS-SECBINFHSA-N
SMILES: c1ccc2c(c1)c(c[nH]2)CC(C(=O)O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Indoles and derivatives
- Subclass: Indolyl carboxylic acids and derivatives
- Class: Indoles and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P00371_DTR | P00371 | D-amino-acid oxidase (DAAO) | n/a | |
2 | P22629_DTR | P22629 | Streptavidin | n/a | |
3 | A0A0E8NFD1_DTR | A0A0E8NFD1 | deleted | n/a | |
4 | P14920_DTR | P14920 | D-amino-acid oxidase (DAAO) | n/a | |
5 | P95481_DTR | P95481 | Monodechloroaminopyrrolnitrin synthase PrnB | n/a | |
6 | Q315G1_DTR | Q315G1 | Solute-binding protein Dde_0634 | n/a | |
7 | A1E280_DTR | A1E280 | Tryptophan 6-halogenase ThaL | n/a | |
8 | P80561_DTR | P80561 | Aminopeptidase S (EC | n/a |