PDB ligand accession: 326
DrugBank: DB03442
PubChem: n/a
ChEMBL: n/a
InChI Key: NOQURKNIKJDEPW-FMQUCBEESA-N
SMILES: Cc1cc(ccc1n2c(c(c(n2)C)N=Nc3cc(ccc3C(=O)O)S(=O)(=O)O)O)S(=O)(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Benzenesulfonic acids and derivatives
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P31335_326 | P31335 | Bifunctional purine biosynthesis | n/a | |
2 | P31939_326 | P31939 | Bifunctional purine biosynthesis | n/a |