PDB ligand accession: CB3
DrugBank: DB03541
PubChem: 443388;5281971;135438608;
ChEMBL:
InChI Key: LTKHPMDRMUCUEB-IBGZPJMESA-N
SMILES: C#CCN(Cc1ccc2c(c1)C(=O)N=C(N2)N)c3ccc(cc3)C(=O)NC(CCC(=O)O)C(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P0A884_CB3 | P0A884 | Thymidylate synthase (TS) | n/a | |
2 | Q27552_CB3 | Q27552 | Bifunctional dihydrofolate reductase-thymidylate | n/a | |
3 | P04818_CB3 | P04818 | Thymidylate synthase (TS) | n/a | |
4 | Q07422_CB3 | Q07422 | Bifunctional dihydrofolate reductase-thymidylate | n/a | |
5 | Q01782_CB3 | Q01782 | Pteridine reductase 1 | n/a | |
6 | P13100_CB3 | P13100 | Thymidylate synthase (TS) | n/a | |
7 | P45351_CB3 | P45351 | Thymidylate synthase (TS) | n/a | |
8 | P00469_CB3 | P00469 | Thymidylate synthase (TS) | n/a | |
9 | P0CG22_CB3 | P0CG22 | Putative dehydrogenase/reductase SDR | n/a | |
10 | Q5CGA3_CB3 | Q5CGA3 | deleted | n/a | |
11 | P16083_CB3 | P16083 | Ribosyldihydronicotinamide dehydrogenase [quinone] | inhibitor |