PDB ligand accession: 137
DrugBank: DB03543
PubChem:
ChEMBL: n/a
InChI Key: AULMJMUNCOBRHC-MXWKQRLJSA-N
SMILES: c1ccc(c(c1)C(=O)O)NCC(C(C(COP(=O)(O)O)O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Benzoic acids and derivatives
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q06121_137 | Q06121 | Indole-3-glycerol phosphate synthase | n/a | |
2 | P06560_137 | P06560 | Tryptophan biosynthesis protein | n/a | |
3 | P60578_137 | P60578 | Phosphoribosyl isomerase A | n/a | |
4 | P00909_137 | P00909 | Tryptophan biosynthesis protein | n/a | |
5 | Q56320_137 | Q56320 | N-(5'-phosphoribosyl)anthranilate isomerase (PRAI) | n/a | |
6 | A0A367MAM9_137 | A0A367MAM9 | Indole-3-glycerol phosphate synthase | n/a |