PDB ligand accession: HXA
DrugBank: DB03756
PubChem:
ChEMBL:
InChI Key: MBMBGCFOFBJSGT-KUBAVDMBSA-N
SMILES: CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Fatty Acyls
- Subclass: Fatty acids and conjugates
- Class: Fatty Acyls
- Superclass: Lipids and lipid-like molecules
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P01106_HXA | P01106 | Myc proto-oncogene protein | inhibitor | |
2 | Q05769_HXA | Q05769 | Prostaglandin G/H synthase | n/a | |
3 | P28702_HXA | P28702 | Retinoic acid receptor | activator | |
4 | Q7NDN8_HXA | Q7NDN8 | Proton-gated ion channel | n/a | |
5 | P65306_HXA | P65306 | Putative phthiocerol dimycocerosate | n/a | |
6 | P67372_HXA | P67372 | DegV domain-containing protein | n/a | |
7 | O15540_HXA | O15540 | Fatty acid-binding protein, | n/a | |
8 | P36956_HXA | P36956 | Sterol regulatory element-binding | inhibitor | |
9 | P48443_HXA | P48443 | Retinoic acid receptor | activator | |
10 | Q07869_HXA | Q07869 | Peroxisome proliferator-activated receptor | activator | |
11 | P19793_HXA | P19793 | Retinoic acid receptor | activator | |
12 | A0A7Y4B3E8_HXA | A0A7Y4B3E8 | SGNH/GDSL hydrolase family | n/a | |
13 | Q5NUL3_HXA | Q5NUL3 | Free fatty acid | n/a | |
14 | P05413_HXA | P05413 | Fatty acid-binding protein, | n/a | |
15 | P37231_HXA | P37231 | Peroxisome proliferator-activated receptor | activator | |
16 | P02754_HXA | P02754 | Beta-lactoglobulin (Beta-LG) (allergen | n/a |