PDB ligand accession: RDC
DrugBank: DB03758
PubChem:
ChEMBL:
InChI Key: WYZWZEOGROVVHK-GTMNPGAYSA-N
SMILES: CC1CC2C(O2)C=CC=CC(=O)Cc3c(c(cc(c3Cl)O)O)C(=O)O1
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Benzoic acids and derivatives
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | Q15120_RDC | Q15120 | [Pyruvate dehydrogenase (acetyl-transferring)] | n/a | |
| 2 | P02829_RDC | P02829 | ATP-dependent molecular chaperone | n/a | |
| 3 | O05207_RDC | O05207 | Type 2 DNA | n/a | |
| 4 | P07900_RDC | P07900 | Heat shock protein | inhibitor | |
| 5 | P41148_RDC | P41148 | Endoplasmin (EC 3.6.4.-) | n/a | |
| 6 | P46598_RDC | P46598 | Heat shock protein | n/a | |
| 7 | P08238_RDC | P08238 | Heat shock protein | n/a | |
| 8 | P14147_RDC | P14147 | Virulence sensor histidine | n/a | |
| 9 | P14625_RDC | P14625 | Endoplasmin (EC 3.6.4.-) | n/a | |
| 10 | P10515_RDC | P10515 | Dihydrolipoyllysine-residue acetyltransferase component | n/a |