PDB ligand accession: BAT
DrugBank: DB03880
PubChem:
ChEMBL:
InChI Key: XFILPEOLDIKJHX-QYZOEREBSA-N
SMILES: CC(C)CC(C(CSc1cccs1)C(=O)NO)C(=O)NC(Cc2ccccc2)C(=O)NC
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P78325_BAT | P78325 | Disintegrin and metalloproteinase | n/a | |
2 | Q9UNA0_BAT | Q9UNA0 | A disintegrin and | n/a | |
3 | Q8TL28_BAT | Q8TL28 | Ulilysin (EC 3.4.24.-) | n/a | |
4 | P22894_BAT | P22894 | Neutrophil collagenase (EC | n/a | IC50(nM) = 700.0 |
5 | P39900_BAT | P39900 | Macrophage metalloelastase (MME) | n/a | |
6 | P15167_BAT | P15167 | Snake venom metalloproteinase | n/a | |
7 | P51512_BAT | P51512 | Matrix metalloproteinase-16 (MMP-16) | n/a | |
8 | Q9UKQ2_BAT | Q9UKQ2 | Disintegrin and metalloproteinase | n/a |