PDB ligand accession: MLC
DrugBank: DB04524
PubChem:
ChEMBL:
InChI Key: LTYOQGRJFJAKNA-DVVLENMVSA-N
SMILES: CC(C)(COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)n2cnc3c2ncnc3N)O)OP(=O)(O)O)C(C(=O)NCCC(=O)NCCSC(=O)CC(=O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Fatty Acyls
- Subclass: Fatty acyl thioesters
- Class: Fatty Acyls
- Superclass: Lipids and lipid-like molecules
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P22033_MLC | P22033 | Methylmalonyl-CoA mutase, mitochondrial | n/a | |
2 | C9ZUV7_MLC | C9ZUV7 | Nonspecific lipid-transfer protein, | n/a | |
3 | O34835_MLC | O34835 | Transcription factor FapR | n/a | |
4 | Q92830_MLC | Q92830 | Histone acetyltransferase KAT2A | n/a | |
5 | A0A059WZ16_MLC | A0A059WZ16 | AAC3-I | n/a | |
6 | Q589Y0_MLC | Q589Y0 | Phenolic glucoside malonyltransferase | n/a | |
7 | Q9L0A2_MLC | Q9L0A2 | Fatty acid synthase | n/a | |
8 | P30074_MLC | P30074 | Chalcone synthase 2 | n/a | |
9 | A4PHY4_MLC | A4PHY4 | Anthocyanin malonyltransferase homolog | n/a | |
10 | P0A6R0_MLC | P0A6R0 | Beta-ketoacyl-[acyl-carrier-protein] synthase III | n/a | |
11 | D6UB50_MLC | D6UB50 | deleted | n/a | |
12 | Q9WZ50_MLC | Q9WZ50 | Fluoroacetyl-CoA-specific thioesterase-like domain-containing | n/a | |
13 | P07149_MLC | P07149 | Fatty acid synthase | n/a | |
14 | P19096_MLC | P19096 | Fatty acid synthase | n/a |