PDB ligand accession: GST
DrugBank: DB04702
PubChem:
ChEMBL: n/a
InChI Key: AKIXWSDUEPPMKM-JXMROGBWSA-N
SMILES: CC(=CCCC(=CCSP(=O)(O)OP(=O)(O)O)C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Monoterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | Q16CN9_GST | Q16CN9 | Geranyltranstransferase (EC 2.5.1.10) | n/a | |
| 2 | O81086_GST | O81086 | Alpha-bisabolene synthase (EC | n/a | |
| 3 | Q9YBM8_GST | Q9YBM8 | 4-hydroxybenzoate octaprenyltransferase (EC | n/a | |
| 4 | M4T4U9_GST | M4T4U9 | Undecaprenyl diphosphate synthase | n/a | |
| 5 | Q9F1Y5_GST | Q9F1Y5 | Geranyl diphosphate 2-C-methyltransferase | n/a | |
| 6 | Q4R2T2_GST | Q4R2T2 | Prenyltransferase | n/a | |
| 7 | P9WFF7_GST | P9WFF7 | Decaprenyl diphosphate synthase | n/a | |
| 8 | Q9F1Y6_GST | Q9F1Y6 | 2-methylisoborneol synthase (2-MIB | n/a | |
| 9 | A0A1B0UHJ4_GST | A0A1B0UHJ4 | Aromatic prenyltransferase | n/a | |
| 10 | A0A372DCN7_GST | A0A372DCN7 | LynF/TruF/PatF family peptide | n/a | |
| 11 | V5TDZ4_GST | V5TDZ4 | AmbP1 (Aromatic prenyltransferase) | n/a | |
| 12 | S0EH60_GST | S0EH60 | Dimethylallyltryptophan synthase 1 | n/a |