PDB ligand accession: IZA
DrugBank: DB04716
PubChem:
ChEMBL:
InChI Key: VNDWQCSOSCCWIP-UHFFFAOYSA-N
SMILES: CC(C)(C)c1[nH]c2c3c(c4cc(ccc4c2n1)F)C(=O)NC=C3
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Isoquinolines and derivatives
- Subclass: Isoquinolones and derivatives
- Class: Isoquinolines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P52333_IZA | P52333 | Tyrosine-protein kinase JAK3 | inhibitor | IC50(nM) = 5.0 |
2 | O60674_IZA | O60674 | Tyrosine-protein kinase JAK2 | inhibitor | IC50(nM) = 1.0 |
3 | Q59GQ2_IZA | Q59GQ2 | Tyrosine-protein kinase JAK1 | n/a | |
4 | G5E852_IZA | G5E852 | Tyrosine-protein kinase JAK2 | n/a | |
5 | P23458_IZA | P23458 | Tyrosine-protein kinase JAK1 | n/a | IC50(nM) = 4.0 |
6 | O43293_IZA | O43293 | Death-associated protein kinase | n/a | |
7 | P29597_IZA | P29597 | Non-receptor tyrosine-protein kinase | inhibitor | IC50(nM) = 1.0 |
8 | P32361_IZA | P32361 | Serine/threonine-protein kinase/endoribonuclease IRE1 | n/a |