Ligand name: Flunarizine
PDB ligand accession: n/a
DrugBank: DB04841
InChI Key:
SMILES: FC1=CC=C(C=C1)C(N1CCN(C\C=C\C2=CC=CC=C2)CC1)C1=CC=C(F)C=C1

List of proteins that are targets for DB04841

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	Q9P0X4_DB04841	Q9P0X4	Voltage-dependent T-type calcium	inhibitor	Kd(nM) = 840.0
2	P0DP23_DB04841	P0DP23	Calmodulin-1	antagonist
3	O95180_DB04841	O95180	Voltage-dependent T-type calcium	inhibitor	Kd(nM) = 3600.0 EC50(nM) = 5620.0
4	P35367_DB04841	P35367	Histamine H1 receptor	antagonist
5	O43497_DB04841	O43497	Voltage-dependent T-type calcium	inhibitor	Kd(nM) = 530.0