Ligand name: Vatalanib
PDB ligand accession: n/a
DrugBank: DB04879
InChI Key:
SMILES: ClC1=CC=C(NC2=NN=C(CC3=CC=NC=C3)C3=CC=CC=C23)C=C1

List of proteins that are targets for DB04879

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P35968_DB04879	P35968	Vascular endothelial growth	inhibitor	IC50(nM) = 15.0 Kd(nM) = 62.0
2	P17948_DB04879	P17948	Vascular endothelial growth	inhibitor	IC50(nM) = 54.0 Kd(nM) = 9.6
3	P35916_DB04879	P35916	Vascular endothelial growth	inhibitor	IC50(nM) = 64.0 Kd(nM) = 190.0