Ligand name: Bifeprunox
PDB ligand accession: n/a
DrugBank: DB04888
InChI Key:
SMILES: O=C1NC2=C(O1)C(=CC=C2)N1CCN(CC2=CC(=CC=C2)C2=CC=CC=C2)CC1

List of proteins that are targets for DB04888

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P08908_DB04888	P08908	5-hydroxytryptamine receptor 1A	modulator	Ki(nM) = 7.19 EC50(nM) = 324.0
2	P14416_DB04888	P14416	D(2) dopamine receptor	modulator	Ki(nM) = 0.04 IC50(nM) = 2.9