Ligand name: Pazopanib
PDB ligand accession: n/a
DrugBank: DB06589
InChI Key:
SMILES: CN(C1=CC2=NN(C)C(C)=C2C=C1)C1=CC=NC(NC2=CC=C(C)C(=C2)S(N)(=O)=O)=N1

List of proteins that are targets for DB06589

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P17948_DB06589	P17948	Vascular endothelial growth	inhibitor	IC50(nM) = 10.0 Kd(nM) = 14.0
2	P22607_DB06589	P22607	Fibroblast growth factor	inhibitor	Kd(nM) = 620.0
3	P16234_DB06589	P16234	Platelet-derived growth factor	inhibitor	IC50(nM) = 71.0 Kd(nM) = 4.9
4	P09619_DB06589	P09619	Platelet-derived growth factor	inhibitor	IC50(nM) = 83.0 Kd(nM) = 2.0
5	P10721_DB06589	P10721	Mast/stem cell growth	inhibitor	Ki(nM) = 2300.0 IC50(nM) = 118.0 Kd(nM) = 1.8
6	Q9UQQ2_DB06589	Q9UQQ2	SH2B adapter protein	inhibitor
7	P35916_DB06589	P35916	Vascular endothelial growth	inhibitor	IC50(nM) = 46.0 Kd(nM) = 27.0
8	Q08881_DB06589	Q08881	Tyrosine-protein kinase ITK/TSK	inhibitor	Kd(nM) = 10000.0
9	P05230_DB06589	P05230	Fibroblast growth factor	inhibitor
10	P35968_DB06589	P35968	Vascular endothelial growth	inhibitor	IC50(nM) = 30.0 Kd(nM) = 14.0