PDB ligand accession: RLT
DrugBank: DB06817
PubChem:
ChEMBL:
InChI Key: CZFFBEXEKNGXKS-UHFFFAOYSA-N
SMILES: Cc1nnc(o1)C(=O)NC(C)(C)C2=NC(=C(C(=O)N2C)O)C(=O)NCc3ccc(cc3)F
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Diazines
- Subclass: Pyrimidines and pyrimidine derivatives
- Class: Diazines
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | Q7JQ07_RLT | Q7JQ07 | Mariner Mos1 transposase | n/a | |
| 2 | Q4QY51_RLT | Q4QY51 | Pol protein | n/a | |
| 3 | P14350_RLT | P14350 | Pro-Pol polyprotein (Pr125Pol) | n/a | |
| 4 | C6Y633_RLT | C6Y633 | Protein PA-X | n/a | |
| 5 | C6H0Y9_RLT | C6H0Y9 | Protein PA-X | n/a |