PDB ligand accession: 444
DrugBank: DB07080
PubChem:
ChEMBL:
InChI Key: SGIWFELWJPNFDH-UHFFFAOYSA-N
SMILES: c1ccc(cc1)S(=O)(=O)N(CC(F)(F)F)c2ccc(cc2)C(C(F)(F)F)(C(F)(F)F)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Sulfanilides
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q15788_444 | Q15788 | Nuclear receptor coactivator | n/a | |
2 | P55055_444 | P55055 | Oxysterols receptor LXR-beta | n/a | Ki(nM) = 17.0 IC50(nM) = 9.0 Kd(nM) = 103.0 EC50(nM) = 0.108 |
3 | P51449_444 | P51449 | Nuclear receptor ROR-gamma | n/a | Ki(nM) = 51.0 IC50(nM) = 60.0 EC50(nM) = 54.0 |
4 | Q13133_444 | Q13133 | Oxysterols receptor LXR-alpha | n/a | Ki(nM) = 24.0 IC50(nM) = 9.0 Kd(nM) = 92.0 EC50(nM) = 0.098 |
5 | P28702_444 | P28702 | Retinoic acid receptor | n/a | |
6 | O75469_444 | O75469 | Nuclear receptor subfamily | n/a | IC50(nM) = 26.0 EC50(nM) = 8.0 |
7 | Q15596_444 | Q15596 | Nuclear receptor coactivator | n/a |