PDB ligand accession: ADB
DrugBank: DB07343
PubChem:
ChEMBL:
InChI Key: NFNNMVVXXITVGD-UHFFFAOYSA-N
SMILES: c1cc(c(c(c1)Cl)Oc2nc(nc(n2)Nc3ccc(cc3)C#N)N)Cl
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic oxygen compounds
- Class: Organooxygen compounds
- Subclass: Ethers
- Class: Organooxygen compounds
- Superclass: Organic oxygen compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P03366_ADB | P03366 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a |