Ligand name: 5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one
PDB ligand accession: AGI
DrugBank: DB07352
PubChem: 5280443
ChEMBL: CHEMBL28
InChI Key: KZNIFHPLKGYRTM-UHFFFAOYSA-N
SMILES: c1cc(ccc1C2=CC(=O)c3c(cc(cc3O2)O)O)O

ClassyFire chemical classification:

List of proteins that are targets for DB07352

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 P28523_AGI P28523 Casein kinase II n/a
2 P53355_AGI P53355 Death-associated protein kinase n/a IC50(nM) = 31000.0
3 Q9H2K2_AGI Q9H2K2 Poly [ADP-ribose] polymerase n/a IC50(nM) = 2900.0
4 P18177_AGI P18177 Toxin B (EC n/a
5 P02766_AGI P02766 Transthyretin (ATTR) (Prealbumin) n/a IC50(nM) = 653.0
Kd(nM) = 250.0
6 Q5G940_AGI Q5G940 3-hydroxyacyl-[acyl-carrier-protein] dehydratase FabZ n/a
7 D5STZ7_AGI D5STZ7 O-methyltransferase family 2 n/a
8 P68400_AGI P68400 Casein kinase II inhibitor Ki(nM) = 740.0
IC50(nM) = 800.0