PDB ligand accession: HOP
DrugBank: DB07909
PubChem:
ChEMBL: n/a
InChI Key: OBWILOKKNDYPLX-HBMCJLEFSA-N
SMILES: c1ccc(cc1)C2CCC(C(C2)O)c3ccc(cc3)C(=O)NCCCC(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P01834_HOP | P01834 | Immunoglobulin kappa constant | n/a | |
| 2 | P01857_HOP | P01857 | Immunoglobulin heavy constant | n/a | |
| 3 | K7T9I5_HOP | K7T9I5 | IgM heavy chain | n/a | |
| 4 | Q7Z3Y4_HOP | Q7Z3Y4 | Ig-like domain-containing protein | n/a | |
| 5 | Q7TS98_HOP | Q7TS98 | Anti-colorectal carcinoma light | n/a |