PDB ligand accession: IQB
DrugBank: DB07995
PubChem:
ChEMBL:
InChI Key: ZKZXNDJNWUTGDK-NSCUHMNNSA-N
SMILES: c1cc2cnccc2c(c1)S(=O)(=O)NCCNCC=Cc3ccc(cc3)Br
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Isoquinolines and derivatives
- Subclass: None
- Class: Isoquinolines and derivatives
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P19525_IQB | P19525 | Interferon-induced, double-stranded RNA-activated | inhibitor | |
| 2 | P00517_IQB | P00517 | cAMP-dependent protein kinase | n/a | IC50(nM) = 73.0 |
| 3 | Q8TF76_IQB | Q8TF76 | Serine/threonine-protein kinase haspin | n/a | |
| 4 | P17612_IQB | P17612 | cAMP-dependent protein kinase | inhibitor | Ki(nM) = 48.0 |