PDB ligand accession: M25
DrugBank: DB08155
PubChem:
ChEMBL: n/a
InChI Key: IIMGUEXQORZTID-UHFFFAOYSA-N
SMILES: CC(=O)NCCc1ccc(cc1)S(=O)(=O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Carboxylic acid derivatives
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P00918_M25 | P00918 | Carbonic anhydrase 2 | inhibitor | |
| 2 | Q12830_M25 | Q12830 | Nucleosome-remodeling factor subunit | n/a | |
| 3 | P01584_M25 | P01584 | Interleukin-1 beta (IL-1 | n/a | |
| 4 | O33877_M25 | O33877 | 3-hydroxydecanoyl-[acyl-carrier-protein] dehydratase (EC | n/a | |
| 5 | P00915_M25 | P00915 | Carbonic anhydrase 1 | inhibitor |