PDB ligand accession: PIT
DrugBank: DB08399
PubChem:
ChEMBL:
InChI Key: CDRPUGZCRXZLFL-OWOJBTEDSA-N
SMILES: c1cc(c(cc1C=Cc2cc(cc(c2)O)O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Phenylpropanoids and polyketides
- Class: Stilbenes
- Subclass: None
- Class: Stilbenes
- Superclass: Phenylpropanoids and polyketides
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P06576_PIT | P06576 | ATP synthase F(1) | n/a | |
2 | Q7S860_PIT | Q7S860 | Carotenoid cleavage oxygenase | n/a | |
3 | P05631_PIT | P05631 | ATP synthase F(1) | n/a | |
4 | P00829_PIT | P00829 | ATP synthase F(1) | n/a | |
5 | P53355_PIT | P53355 | Death-associated protein kinase | n/a | |
6 | Q9NTG7_PIT | Q9NTG7 | NAD-dependent protein deacetylase | n/a | |
7 | P02766_PIT | P02766 | Transthyretin (ATTR) (Prealbumin) | n/a | Ki(nM) = 5400.0 Kd(nM) = 1500.0 |
8 | P19483_PIT | P19483 | ATP synthase F(1) | n/a | |
9 | P25705_PIT | P25705 | ATP synthase F(1) | n/a | |
10 | P36542_PIT | P36542 | ATP synthase F(1) | n/a |