PDB ligand accession: PLH
DrugBank: DB08403
PubChem:
ChEMBL:
InChI Key: MOPRTFSMCQNUCT-CABCVRRESA-N
SMILES: CC(C)CC(CC(=O)NO)C(=O)NC(Cc1ccccc1)C(=O)NC
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P22894_PLH | P22894 | Neutrophil collagenase (EC | inhibitor | Ki(nM) = 1.0 IC50(nM) = 0.046 |
| 2 | P03956_PLH | P03956 | Interstitial collagenase (EC | inhibitor | Ki(nM) = 6.0 IC50(nM) = 3.0 |