PDB ligand accession: TCL
DrugBank: DB08604
PubChem:
ChEMBL:
InChI Key: XEFQLINVKFYRCS-UHFFFAOYSA-N
SMILES: c1cc(c(cc1Cl)O)Oc2ccc(cc2Cl)Cl
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Diphenylethers
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P80030_TCL | P80030 | Enoyl-[acyl-carrier-protein] reductase [NADH], | n/a | |
| 2 | A0A069B9A4_TCL | A0A069B9A4 | Enoyl-[acyl-carrier-protein] reductase [NADH] | n/a | |
| 3 | Q5SLI9_TCL | Q5SLI9 | Enoyl-[acyl-carrier-protein] reductase [NADH] | n/a | |
| 4 | Q9BH77_TCL | Q9BH77 | Enoyl-ACP reductase (Enoyl-acyl | n/a | |
| 5 | P0A5Y6_TCL | P0A5Y6 | Enoyl-[acyl-carrier-protein] reductase [NADH] | n/a | |
| 6 | P29132_TCL | P29132 | Enoyl-[acyl-carrier-protein] reductase [NADH] | n/a | |
| 7 | Q6TEI5_TCL | Q6TEI5 | Enoyl-acyl carrier protein | n/a | |
| 8 | Q6GI75_TCL | Q6GI75 | Enoyl-[acyl-carrier-protein] reductase [NADPH] | n/a | Ki(nM) = 0.05 IC50(nM) = 59.0 |
| 9 | O24990_TCL | O24990 | Enoyl-[acyl-carrier-protein] reductase [NADH] | n/a | |
| 10 | P10275_TCL | P10275 | Androgen receptor (Dihydrotestosterone | n/a | |
| 11 | Q9ZFE4_TCL | Q9ZFE4 | Enoyl-[acyl-carrier-protein] reductase [NADH] | n/a | |
| 12 | P49327_TCL | P49327 | Fatty acid synthase | n/a | |
| 13 | Q8KLP4_TCL | Q8KLP4 | Repressor | n/a | |
| 14 | Q5NGQ3_TCL | Q5NGQ3 | Enoyl-[acyl-carrier-protein] reductase [NADH] | n/a | |
| 15 | Q6UCJ9_TCL | Q6UCJ9 | Enoyl-acyl carrier reductase | n/a | |
| 16 | P71079_TCL | P71079 | Enoyl-[acyl-carrier-protein] reductase [NADPH] | n/a | |
| 17 | A0A2J1CZK4_TCL | A0A2J1CZK4 | deleted | n/a | |
| 18 | P37231_TCL | P37231 | Peroxisome proliferator-activated receptor | n/a | |
| 19 | Q14994_TCL | Q14994 | Nuclear receptor subfamily | inverse agonist | |
| 20 | A1KVU8_TCL | A1KVU8 | Enoyl-[acyl-carrier-protein] reductase [NADH] | n/a | |
| 21 | O75469_TCL | O75469 | Nuclear receptor subfamily | n/a | |
| 22 | P07202_TCL | P07202 | Thyroid peroxidase (TPO) | weak inhibitor | |
| 23 | Q7A6D8_TCL | Q7A6D8 | deleted | n/a | |
| 24 | Q9BJJ9_TCL | Q9BJJ9 | Enoyl-ACP reductase | n/a | |
| 25 | D5VCE0_TCL | D5VCE0 | deleted | n/a | |
| 26 | P54616_TCL | P54616 | Enoyl-[acyl-carrier-protein] reductase [NADH] | n/a | IC50(nM) = 500.0 |
| 27 | Q81JF8_TCL | Q81JF8 | Enoyl-[acyl-carrier-protein] reductase [NADH] | n/a | |
| 28 | Q6LFB9_TCL | Q6LFB9 | deleted | n/a | |
| 29 | Q81GI3_TCL | Q81GI3 | Enoyl-[acyl-carrier-protein] reductase [NADH] | n/a | |
| 30 | P0AEK4_TCL | P0AEK4 | Enoyl-[acyl-carrier-protein] reductase [NADH] | n/a | Ki(nM) = 0.007 IC50(nM) = 5.0 |